C15H14ClN3 — CID 107049902
2-chloro-6-(5,6-dimethyl-1H-benzimidazol-2-yl)aniline (PubChem CID 107049902) has the molecular formula C15H14ClN3 and a molecular weight of 271.75 g/mol. Its IUPAC name is 2-chloro-6-(5,6-dimethyl-1H-benzimidazol-2-yl)aniline.
| Compound Name | 2-chloro-6-(5,6-dimethyl-1H-benzimidazol-2-yl)aniline |
|---|---|
| PubChem CID | 107049902 |
| Molecular Formula | C15H14ClN3 |
| Molecular Weight | 271.75 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | 2-chloro-6-(5,6-dimethyl-1H-benzimidazol-2-yl)aniline |
| SMILES | Cc1cc2nc(-c3cccc(Cl)c3N)[nH]c2cc1C |
| InChI | InChI=1S/C15H14ClN3/c1-8-6-12-13(7-9(8)2)19-15(18-12)10-4-3-5-11(16)14(10)17/h3-7H,17H2,1-2H3,(H,18,19) |
| InChIKey | DKSYKHXEDOTPGP-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.75 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|