C16H18N4 — CID 56736956
5-(5,6-dimethyl-1H-benzimidazol-2-yl)-2-methylbenzene-1,3-diamine (PubChem CID 56736956) has the molecular formula C16H18N4 and a molecular weight of 266.35 g/mol. Its IUPAC name is 5-(5,6-dimethyl-1H-benzimidazol-2-yl)-2-methylbenzene-1,3-diamine.
| Compound Name | 5-(5,6-dimethyl-1H-benzimidazol-2-yl)-2-methylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 56736956 |
| Molecular Formula | C16H18N4 |
| Molecular Weight | 266.35 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 5-(5,6-dimethyl-1H-benzimidazol-2-yl)-2-methylbenzene-1,3-diamine |
| SMILES | Cc1cc2nc(-c3cc(N)c(C)c(N)c3)[nH]c2cc1C |
| InChI | InChI=1S/C16H18N4/c1-8-4-14-15(5-9(8)2)20-16(19-14)11-6-12(17)10(3)13(18)7-11/h4-7H,17-18H2,1-3H3,(H,19,20) |
| InChIKey | GYSUWIDQKOIRFO-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 80.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.35 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|