C15H13Cl2N3 — CID 56736961
2,3-dichloro-5-(5,6-dimethyl-1H-benzimidazol-2-yl)aniline (PubChem CID 56736961) has the molecular formula C15H13Cl2N3 and a molecular weight of 306.20 g/mol. Its IUPAC name is 2,3-dichloro-5-(5,6-dimethyl-1H-benzimidazol-2-yl)aniline.
| Compound Name | 2,3-dichloro-5-(5,6-dimethyl-1H-benzimidazol-2-yl)aniline |
|---|---|
| PubChem CID | 56736961 |
| Molecular Formula | C15H13Cl2N3 |
| Molecular Weight | 306.20 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | 2,3-dichloro-5-(5,6-dimethyl-1H-benzimidazol-2-yl)aniline |
| SMILES | Cc1cc2nc(-c3cc(N)c(Cl)c(Cl)c3)[nH]c2cc1C |
| InChI | InChI=1S/C15H13Cl2N3/c1-7-3-12-13(4-8(7)2)20-15(19-12)9-5-10(16)14(17)11(18)6-9/h3-6H,18H2,1-2H3,(H,19,20) |
| InChIKey | FQEUYALKZDANQW-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.20 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|