C16H13ClN4 — CID 135804648
2-(4-chloro-1H-indazol-3-yl)-5,6-dimethyl-1H-benzimidazole (PubChem CID 135804648) has the molecular formula C16H13ClN4 and a molecular weight of 296.76 g/mol. Its IUPAC name is 2-(4-chloro-1H-indazol-3-yl)-5,6-dimethyl-1H-benzimidazole.
| Compound Name | 2-(4-chloro-1H-indazol-3-yl)-5,6-dimethyl-1H-benzimidazole |
|---|---|
| PubChem CID | 135804648 |
| Molecular Formula | C16H13ClN4 |
| Molecular Weight | 296.76 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 2-(4-chloro-1H-indazol-3-yl)-5,6-dimethyl-1H-benzimidazole |
| SMILES | Cc1cc2nc(-c3n[nH]c4cccc(Cl)c34)[nH]c2cc1C |
| InChI | InChI=1S/C16H13ClN4/c1-8-6-12-13(7-9(8)2)19-16(18-12)15-14-10(17)4-3-5-11(14)20-21-15/h3-7H,1-2H3,(H,18,19)(H,20,21) |
| InChIKey | SGEDBOAJPCXONK-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.76 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |