C15H14N2O2 — CID 136903792
4-(5,6-dimethyl-1H-benzimidazol-2-yl)benzene-1,3-diol (PubChem CID 136903792) has the molecular formula C15H14N2O2 and a molecular weight of 254.29 g/mol. Its IUPAC name is 4-(5,6-dimethyl-1H-benzimidazol-2-yl)benzene-1,3-diol.
| Compound Name | 4-(5,6-dimethyl-1H-benzimidazol-2-yl)benzene-1,3-diol |
|---|---|
| PubChem CID | 136903792 |
| Molecular Formula | C15H14N2O2 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 4-(5,6-dimethyl-1H-benzimidazol-2-yl)benzene-1,3-diol |
| SMILES | Cc1cc2nc(-c3ccc(O)cc3O)[nH]c2cc1C |
| InChI | InChI=1S/C15H14N2O2/c1-8-5-12-13(6-9(8)2)17-15(16-12)11-4-3-10(18)7-14(11)19/h3-7,18-19H,1-2H3,(H,16,17) |
| InChIKey | ZUJGWAKEXODNLN-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 69.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |