C13H9ClN2O2 — CID 136903703
4-(6-chloro-1H-benzimidazol-2-yl)benzene-1,3-diol (PubChem CID 136903703) has the molecular formula C13H9ClN2O2 and a molecular weight of 260.68 g/mol. Its IUPAC name is 4-(6-chloro-1H-benzimidazol-2-yl)benzene-1,3-diol.
| Compound Name | 4-(6-chloro-1H-benzimidazol-2-yl)benzene-1,3-diol |
|---|---|
| PubChem CID | 136903703 |
| Molecular Formula | C13H9ClN2O2 |
| Molecular Weight | 260.68 g/mol |
| Exact Mass | 260.04 |
| IUPAC Name | 4-(6-chloro-1H-benzimidazol-2-yl)benzene-1,3-diol |
| SMILES | Oc1ccc(-c2nc3ccc(Cl)cc3[nH]2)c(O)c1 |
| InChI | InChI=1S/C13H9ClN2O2/c14-7-1-4-10-11(5-7)16-13(15-10)9-3-2-8(17)6-12(9)18/h1-6,17-18H,(H,15,16) |
| InChIKey | TWVGERZBFIWVPQ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 69.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.68 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |