C15H15N3O — CID 81432836
2-(2-amino-3,5-dimethylphenyl)-3H-benzimidazol-5-ol (PubChem CID 81432836) has the molecular formula C15H15N3O and a molecular weight of 253.31 g/mol. Its IUPAC name is 2-(2-amino-3,5-dimethylphenyl)-3H-benzimidazol-5-ol.
| Compound Name | 2-(2-amino-3,5-dimethylphenyl)-3H-benzimidazol-5-ol |
|---|---|
| PubChem CID | 81432836 |
| Molecular Formula | C15H15N3O |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 2-(2-amino-3,5-dimethylphenyl)-3H-benzimidazol-5-ol |
| SMILES | Cc1cc(C)c(N)c(-c2nc3ccc(O)cc3[nH]2)c1 |
| InChI | InChI=1S/C15H15N3O/c1-8-5-9(2)14(16)11(6-8)15-17-12-4-3-10(19)7-13(12)18-15/h3-7,19H,16H2,1-2H3,(H,17,18) |
| InChIKey | SSDUGGORHLCYRR-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 74.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|