C9H9FN4O — CID 169499779
5-(4-fluoro-2-methoxyphenyl)-1H-1,2,4-triazol-3-amine (PubChem CID 169499779) has the molecular formula C9H9FN4O and a molecular weight of 208.20 g/mol. Its IUPAC name is 5-(4-fluoro-2-methoxyphenyl)-1H-1,2,4-triazol-3-amine.
| Compound Name | 5-(4-fluoro-2-methoxyphenyl)-1H-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 169499779 |
| Molecular Formula | C9H9FN4O |
| Molecular Weight | 208.20 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | 5-(4-fluoro-2-methoxyphenyl)-1H-1,2,4-triazol-3-amine |
| SMILES | COc1cc(F)ccc1-c1nc(N)n[nH]1 |
| InChI | InChI=1S/C9H9FN4O/c1-15-7-4-5(10)2-3-6(7)8-12-9(11)14-13-8/h2-4H,1H3,(H3,11,12,13,14) |
| InChIKey | GJHVTCUIWZRBTR-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.20 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |