C10H11FN4O2 — CID 156565763
5-(5-fluoro-2-methoxyphenyl)-N-methoxy-1H-1,2,4-triazol-3-amine (PubChem CID 156565763) has the molecular formula C10H11FN4O2 and a molecular weight of 238.22 g/mol. Its IUPAC name is 5-(5-fluoro-2-methoxyphenyl)-N-methoxy-1H-1,2,4-triazol-3-amine.
| Compound Name | 5-(5-fluoro-2-methoxyphenyl)-N-methoxy-1H-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 156565763 |
| Molecular Formula | C10H11FN4O2 |
| Molecular Weight | 238.22 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | 5-(5-fluoro-2-methoxyphenyl)-N-methoxy-1H-1,2,4-triazol-3-amine |
| SMILES | CONc1n[nH]c(-c2cc(F)ccc2OC)n1 |
| InChI | InChI=1S/C10H11FN4O2/c1-16-8-4-3-6(11)5-7(8)9-12-10(14-13-9)15-17-2/h3-5H,1-2H3,(H2,12,13,14,15) |
| InChIKey | ZOLQNJHPSWLHLP-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.22 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|