C12H14FN3O — CID 82083321
5-ethyl-4-(5-fluoro-2-methoxyphenyl)-1H-pyrazol-3-amine (PubChem CID 82083321) has the molecular formula C12H14FN3O and a molecular weight of 235.26 g/mol. Its IUPAC name is 5-ethyl-4-(5-fluoro-2-methoxyphenyl)-1H-pyrazol-3-amine.
| Compound Name | 5-ethyl-4-(5-fluoro-2-methoxyphenyl)-1H-pyrazol-3-amine |
|---|---|
| PubChem CID | 82083321 |
| Molecular Formula | C12H14FN3O |
| Molecular Weight | 235.26 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | 5-ethyl-4-(5-fluoro-2-methoxyphenyl)-1H-pyrazol-3-amine |
| SMILES | CCc1[nH]nc(N)c1-c1cc(F)ccc1OC |
| InChI | InChI=1S/C12H14FN3O/c1-3-9-11(12(14)16-15-9)8-6-7(13)4-5-10(8)17-2/h4-6H,3H2,1-2H3,(H3,14,15,16) |
| InChIKey | JJGLUWCOJNMHBZ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.26 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |