C10H9FN4O — CID 82392808
5-(5-fluoro-2-methoxyphenyl)-1,2,4-triazin-3-amine (PubChem CID 82392808) has the molecular formula C10H9FN4O and a molecular weight of 220.21 g/mol. Its IUPAC name is 5-(5-fluoro-2-methoxyphenyl)-1,2,4-triazin-3-amine.
| Compound Name | 5-(5-fluoro-2-methoxyphenyl)-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 82392808 |
| Molecular Formula | C10H9FN4O |
| Molecular Weight | 220.21 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 5-(5-fluoro-2-methoxyphenyl)-1,2,4-triazin-3-amine |
| SMILES | COc1ccc(F)cc1-c1cnnc(N)n1 |
| InChI | InChI=1S/C10H9FN4O/c1-16-9-3-2-6(11)4-7(9)8-5-13-15-10(12)14-8/h2-5H,1H3,(H2,12,14,15) |
| InChIKey | AAHRPQVCLLYITH-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 73.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.21 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |