C11H10FNOS2 — CID 116965875
[4-(5-fluoro-2-methoxyphenyl)-1,3-thiazol-2-yl]methanethiol (PubChem CID 116965875) has the molecular formula C11H10FNOS2 and a molecular weight of 255.34 g/mol. Its IUPAC name is [4-(5-fluoro-2-methoxyphenyl)-1,3-thiazol-2-yl]methanethiol.
| Compound Name | [4-(5-fluoro-2-methoxyphenyl)-1,3-thiazol-2-yl]methanethiol |
|---|---|
| PubChem CID | 116965875 |
| Molecular Formula | C11H10FNOS2 |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.02 |
| IUPAC Name | [4-(5-fluoro-2-methoxyphenyl)-1,3-thiazol-2-yl]methanethiol |
| SMILES | COc1ccc(F)cc1-c1csc(CS)n1 |
| InChI | InChI=1S/C11H10FNOS2/c1-14-10-3-2-7(12)4-8(10)9-6-16-11(5-15)13-9/h2-4,6,15H,5H2,1H3 |
| InChIKey | XFHJYSFEYUBOMF-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 22.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|