C12H12ClNO2S — CID 62922717
2-(chloromethyl)-4-(2,5-dimethoxyphenyl)-1,3-thiazole (PubChem CID 62922717) has the molecular formula C12H12ClNO2S and a molecular weight of 269.75 g/mol. Its IUPAC name is 2-(chloromethyl)-4-(2,5-dimethoxyphenyl)-1,3-thiazole.
| Compound Name | 2-(chloromethyl)-4-(2,5-dimethoxyphenyl)-1,3-thiazole |
|---|---|
| PubChem CID | 62922717 |
| Molecular Formula | C12H12ClNO2S |
| Molecular Weight | 269.75 g/mol |
| Exact Mass | 269.03 |
| IUPAC Name | 2-(chloromethyl)-4-(2,5-dimethoxyphenyl)-1,3-thiazole |
| SMILES | COc1ccc(OC)c(-c2csc(CCl)n2)c1 |
| InChI | InChI=1S/C12H12ClNO2S/c1-15-8-3-4-11(16-2)9(5-8)10-7-17-12(6-13)14-10/h3-5,7H,6H2,1-2H3 |
| InChIKey | OVCCVDJETPTVBN-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.75 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|