C17H14FNOS — CID 8963152
4-(5-fluoro-2-methoxyphenyl)-2-(4-methylphenyl)-1,3-thiazole (PubChem CID 8963152) has the molecular formula C17H14FNOS and a molecular weight of 299.37 g/mol. Its IUPAC name is 4-(5-fluoro-2-methoxyphenyl)-2-(4-methylphenyl)-1,3-thiazole.
| Compound Name | 4-(5-fluoro-2-methoxyphenyl)-2-(4-methylphenyl)-1,3-thiazole |
|---|---|
| PubChem CID | 8963152 |
| Molecular Formula | C17H14FNOS |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | 4-(5-fluoro-2-methoxyphenyl)-2-(4-methylphenyl)-1,3-thiazole |
| SMILES | COc1ccc(F)cc1-c1csc(-c2ccc(C)cc2)n1 |
| InChI | InChI=1S/C17H14FNOS/c1-11-3-5-12(6-4-11)17-19-15(10-21-17)14-9-13(18)7-8-16(14)20-2/h3-10H,1-2H3 |
| InChIKey | KNDMHDRMFXULKE-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |