C18H17NO3S — CID 9452291
2-(3,4-dimethoxyphenyl)-4-(2-methoxyphenyl)-1,3-thiazole (PubChem CID 9452291) has the molecular formula C18H17NO3S and a molecular weight of 327.41 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-4-(2-methoxyphenyl)-1,3-thiazole.
| Compound Name | 2-(3,4-dimethoxyphenyl)-4-(2-methoxyphenyl)-1,3-thiazole |
|---|---|
| PubChem CID | 9452291 |
| Molecular Formula | C18H17NO3S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-4-(2-methoxyphenyl)-1,3-thiazole |
| SMILES | COc1ccc(-c2nc(-c3ccccc3OC)cs2)cc1OC |
| InChI | InChI=1S/C18H17NO3S/c1-20-15-7-5-4-6-13(15)14-11-23-18(19-14)12-8-9-16(21-2)17(10-12)22-3/h4-11H,1-3H3 |
| InChIKey | CUWNNXCQMNACPM-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |