C20H21N3OS — CID 103597457
4-(2-methoxyphenyl)-2-(2-piperidin-1-yl-4-pyridinyl)-1,3-thiazole (PubChem CID 103597457) has the molecular formula C20H21N3OS and a molecular weight of 351.48 g/mol. Its IUPAC name is 4-(2-methoxyphenyl)-2-(2-piperidin-1-yl-4-pyridinyl)-1,3-thiazole.
| Compound Name | 4-(2-methoxyphenyl)-2-(2-piperidin-1-yl-4-pyridinyl)-1,3-thiazole |
|---|---|
| PubChem CID | 103597457 |
| Molecular Formula | C20H21N3OS |
| Molecular Weight | 351.48 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | 4-(2-methoxyphenyl)-2-(2-piperidin-1-yl-4-pyridinyl)-1,3-thiazole |
| SMILES | COc1ccccc1-c1csc(-c2ccnc(N3CCCCC3)c2)n1 |
| InChI | InChI=1S/C20H21N3OS/c1-24-18-8-4-3-7-16(18)17-14-25-20(22-17)15-9-10-21-19(13-15)23-11-5-2-6-12-23/h3-4,7-10,13-14H,2,5-6,11-12H2,1H3 |
| InChIKey | LLCQNMPZEIZQGF-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.48 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |