C16H14N2O2S — CID 23408094
4-(2,4-dimethoxyphenyl)-2-pyridin-4-yl-1,3-thiazole (PubChem CID 23408094) has the molecular formula C16H14N2O2S and a molecular weight of 298.37 g/mol. Its IUPAC name is 4-(2,4-dimethoxyphenyl)-2-pyridin-4-yl-1,3-thiazole.
| Compound Name | 4-(2,4-dimethoxyphenyl)-2-pyridin-4-yl-1,3-thiazole |
|---|---|
| PubChem CID | 23408094 |
| Molecular Formula | C16H14N2O2S |
| Molecular Weight | 298.37 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 4-(2,4-dimethoxyphenyl)-2-pyridin-4-yl-1,3-thiazole |
| SMILES | COc1ccc(-c2csc(-c3ccncc3)n2)c(OC)c1 |
| InChI | InChI=1S/C16H14N2O2S/c1-19-12-3-4-13(15(9-12)20-2)14-10-21-16(18-14)11-5-7-17-8-6-11/h3-10H,1-2H3 |
| InChIKey | XFBUHXHQDVKLKE-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.37 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |