C11H11N2O2S- — CID 161351760
[4-(2,4-dimethoxyphenyl)-1,3-thiazol-2-yl]azanide (PubChem CID 161351760) has the molecular formula C11H11N2O2S- and a molecular weight of 235.29 g/mol. Its IUPAC name is [4-(2,4-dimethoxyphenyl)-1,3-thiazol-2-yl]azanide.
| Compound Name | [4-(2,4-dimethoxyphenyl)-1,3-thiazol-2-yl]azanide |
|---|---|
| PubChem CID | 161351760 |
| Molecular Formula | C11H11N2O2S- |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.05 |
| IUPAC Name | [4-(2,4-dimethoxyphenyl)-1,3-thiazol-2-yl]azanide |
| SMILES | COc1ccc(-c2csc([NH-])n2)c(OC)c1 |
| InChI | InChI=1S/C11H11N2O2S/c1-14-7-3-4-8(10(5-7)15-2)9-6-16-11(12)13-9/h3-6H,1-2H3,(H-,12,13)/q-1 |
| InChIKey | VOAAYTOFUFXQGZ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 55.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |