C17H21NO4S — CID 125138855
4-(2,4-dimethoxyphenyl)-2-(4-methoxyoxan-4-yl)-1,3-thiazole (PubChem CID 125138855) has the molecular formula C17H21NO4S and a molecular weight of 335.43 g/mol. Its IUPAC name is 4-(2,4-dimethoxyphenyl)-2-(4-methoxyoxan-4-yl)-1,3-thiazole.
| Compound Name | 4-(2,4-dimethoxyphenyl)-2-(4-methoxyoxan-4-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 125138855 |
| Molecular Formula | C17H21NO4S |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | 4-(2,4-dimethoxyphenyl)-2-(4-methoxyoxan-4-yl)-1,3-thiazole |
| SMILES | COc1ccc(-c2csc(C3(OC)CCOCC3)n2)c(OC)c1 |
| InChI | InChI=1S/C17H21NO4S/c1-19-12-4-5-13(15(10-12)20-2)14-11-23-16(18-14)17(21-3)6-8-22-9-7-17/h4-5,10-11H,6-9H2,1-3H3 |
| InChIKey | MUAJKORCBDSXKR-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 49.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |