C15H16BrNO2S — CID 116782540
4-(3-bromophenyl)-2-(4-methoxyoxan-4-yl)-1,3-thiazole (PubChem CID 116782540) has the molecular formula C15H16BrNO2S and a molecular weight of 354.27 g/mol. Its IUPAC name is 4-(3-bromophenyl)-2-(4-methoxyoxan-4-yl)-1,3-thiazole.
| Compound Name | 4-(3-bromophenyl)-2-(4-methoxyoxan-4-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 116782540 |
| Molecular Formula | C15H16BrNO2S |
| Molecular Weight | 354.27 g/mol |
| Exact Mass | 353.01 |
| IUPAC Name | 4-(3-bromophenyl)-2-(4-methoxyoxan-4-yl)-1,3-thiazole |
| SMILES | COC1(c2nc(-c3cccc(Br)c3)cs2)CCOCC1 |
| InChI | InChI=1S/C15H16BrNO2S/c1-18-15(5-7-19-8-6-15)14-17-13(10-20-14)11-3-2-4-12(16)9-11/h2-4,9-10H,5-8H2,1H3 |
| InChIKey | GJEFHIHSFAHLNI-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.27 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |