C12H18ClNO2S — CID 116744349
4-(3-chloropropyl)-2-(4-methoxyoxan-4-yl)-1,3-thiazole (PubChem CID 116744349) has the molecular formula C12H18ClNO2S and a molecular weight of 275.80 g/mol. Its IUPAC name is 4-(3-chloropropyl)-2-(4-methoxyoxan-4-yl)-1,3-thiazole.
| Compound Name | 4-(3-chloropropyl)-2-(4-methoxyoxan-4-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 116744349 |
| Molecular Formula | C12H18ClNO2S |
| Molecular Weight | 275.80 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | 4-(3-chloropropyl)-2-(4-methoxyoxan-4-yl)-1,3-thiazole |
| SMILES | COC1(c2nc(CCCCl)cs2)CCOCC1 |
| InChI | InChI=1S/C12H18ClNO2S/c1-15-12(4-7-16-8-5-12)11-14-10(9-17-11)3-2-6-13/h9H,2-8H2,1H3 |
| InChIKey | CGBUGEODRVFIBS-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.80 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|