C13H19NO4S — CID 116744559
methyl 2-[2-(4-ethoxyoxan-4-yl)-1,3-thiazol-4-yl]acetate (PubChem CID 116744559) has the molecular formula C13H19NO4S and a molecular weight of 285.37 g/mol. Its IUPAC name is methyl 2-[2-(4-ethoxyoxan-4-yl)-1,3-thiazol-4-yl]acetate.
| Compound Name | methyl 2-[2-(4-ethoxyoxan-4-yl)-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 116744559 |
| Molecular Formula | C13H19NO4S |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | methyl 2-[2-(4-ethoxyoxan-4-yl)-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC1(c2nc(CC(=O)OC)cs2)CCOCC1 |
| InChI | InChI=1S/C13H19NO4S/c1-3-18-13(4-6-17-7-5-13)12-14-10(9-19-12)8-11(15)16-2/h9H,3-8H2,1-2H3 |
| InChIKey | ZKNCEQMAISJQCU-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |