C15H23NO3S — CID 116744539
ethyl 2-[2-(1-methoxycycloheptyl)-1,3-thiazol-4-yl]acetate (PubChem CID 116744539) has the molecular formula C15H23NO3S and a molecular weight of 297.42 g/mol. Its IUPAC name is ethyl 2-[2-(1-methoxycycloheptyl)-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-(1-methoxycycloheptyl)-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 116744539 |
| Molecular Formula | C15H23NO3S |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | ethyl 2-[2-(1-methoxycycloheptyl)-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(C2(OC)CCCCCC2)n1 |
| InChI | InChI=1S/C15H23NO3S/c1-3-19-13(17)10-12-11-20-14(16-12)15(18-2)8-6-4-5-7-9-15/h11H,3-10H2,1-2H3 |
| InChIKey | OPKYTYURMWOQDR-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |