C13H20N2O2S — CID 80574155
ethyl 2-[2-(azepan-1-yl)-1,3-thiazol-4-yl]acetate (PubChem CID 80574155) has the molecular formula C13H20N2O2S and a molecular weight of 268.38 g/mol. Its IUPAC name is ethyl 2-[2-(azepan-1-yl)-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-(azepan-1-yl)-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 80574155 |
| Molecular Formula | C13H20N2O2S |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | ethyl 2-[2-(azepan-1-yl)-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(N2CCCCCC2)n1 |
| InChI | InChI=1S/C13H20N2O2S/c1-2-17-12(16)9-11-10-18-13(14-11)15-7-5-3-4-6-8-15/h10H,2-9H2,1H3 |
| InChIKey | CFPQPAQJAFEESL-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |