C10H15NO3S — CID 78992497
methyl 2-[2-(1-ethoxyethyl)-1,3-thiazol-4-yl]acetate (PubChem CID 78992497) has the molecular formula C10H15NO3S and a molecular weight of 229.30 g/mol. Its IUPAC name is methyl 2-[2-(1-ethoxyethyl)-1,3-thiazol-4-yl]acetate.
| Compound Name | methyl 2-[2-(1-ethoxyethyl)-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 78992497 |
| Molecular Formula | C10H15NO3S |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.08 |
| IUPAC Name | methyl 2-[2-(1-ethoxyethyl)-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(C)c1nc(CC(=O)OC)cs1 |
| InChI | InChI=1S/C10H15NO3S/c1-4-14-7(2)10-11-8(6-15-10)5-9(12)13-3/h6-7H,4-5H2,1-3H3 |
| InChIKey | KOPXBRFIWYVLDH-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |