C16H19IN2O2S — CID 86964848
2-[2-(1-ethoxyethyl)-1,3-thiazol-4-yl]-N-(3-iodo-4-methylphenyl)acetamide (PubChem CID 86964848) has the molecular formula C16H19IN2O2S and a molecular weight of 430.31 g/mol. Its IUPAC name is 2-[2-(1-ethoxyethyl)-1,3-thiazol-4-yl]-N-(3-iodo-4-methylphenyl)acetamide.
| Compound Name | 2-[2-(1-ethoxyethyl)-1,3-thiazol-4-yl]-N-(3-iodo-4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 86964848 |
| Molecular Formula | C16H19IN2O2S |
| Molecular Weight | 430.31 g/mol |
| Exact Mass | 430.02 |
| IUPAC Name | 2-[2-(1-ethoxyethyl)-1,3-thiazol-4-yl]-N-(3-iodo-4-methylphenyl)acetamide |
| SMILES | CCOC(C)c1nc(CC(=O)Nc2ccc(C)c(I)c2)cs1 |
| InChI | InChI=1S/C16H19IN2O2S/c1-4-21-11(3)16-19-13(9-22-16)8-15(20)18-12-6-5-10(2)14(17)7-12/h5-7,9,11H,4,8H2,1-3H3,(H,18,20) |
| InChIKey | VZMVDDJLJBAJDE-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.31 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|