About [4-[2,2-dimethylpropanoyl(methyl)amino]phenyl] 2-[2-(1-ethoxyethyl)-1,3-thiazol-4-yl]acetate
[4-[2,2-dimethylpropanoyl(methyl)amino]phenyl] 2-[2-(1-ethoxyethyl)-1,3-thiazol-4-yl]acetate (PubChem CID 86964837) has the molecular formula C21H28N2O4S
and a molecular weight of 404.53 g/mol. Its IUPAC name is [4-[2,2-dimethylpropanoyl(methyl)amino]phenyl] 2-[2-(1-ethoxyethyl)-1,3-thiazol-4-yl]acetate.
Molecular Properties
| Compound Name | [4-[2,2-dimethylpropanoyl(methyl)amino]phenyl] 2-[2-(1-ethoxyethyl)-1,3-thiazol-4-yl]acetate |
| PubChem CID | 86964837 |
| Molecular Formula | C21H28N2O4S |
| Molecular Weight | 404.53 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | [4-[2,2-dimethylpropanoyl(methyl)amino]phenyl] 2-[2-(1-ethoxyethyl)-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(C)c1nc(CC(=O)Oc2ccc(N(C)C(=O)C(C)(C)C)cc2)cs1 |
| InChI | InChI=1S/C21H28N2O4S/c1-7-26-14(2)19-22-15(13-28-19)12-18(24)27-17-10-8-16(9-11-17)23(6)20(25)21(3,4)5/h8-11,13-14H,7,12H2,1-6H3 |
| InChIKey | RUBLLLLSFXNZNQ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.53 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-[2,2-dimethylpropanoyl(methyl)amino]phenyl] 2-[2-(1-ethoxyethyl)-1,3-thiazol-4-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[2,2-dimethylpropanoyl(methyl)amino]phenyl] 2-[2-(1-ethoxyethyl)-1,3-thiazol-4-yl]acetate?
The IUPAC name of [4-[2,2-dimethylpropanoyl(methyl)amino]phenyl] 2-[2-(1-ethoxyethyl)-1,3-thiazol-4-yl]acetate (CID 86964837) is [4-[2,2-dimethylpropanoyl(methyl)amino]phenyl] 2-[2-(1-ethoxyethyl)-1,3-thiazol-4-yl]acetate.
What is the SMILES notation for [4-[2,2-dimethylpropanoyl(methyl)amino]phenyl] 2-[2-(1-ethoxyethyl)-1,3-thiazol-4-yl]acetate?
The canonical SMILES for [4-[2,2-dimethylpropanoyl(methyl)amino]phenyl] 2-[2-(1-ethoxyethyl)-1,3-thiazol-4-yl]acetate is CCOC(C)c1nc(CC(=O)Oc2ccc(N(C)C(=O)C(C)(C)C)cc2)cs1.
What is the InChIKey of [4-[2,2-dimethylpropanoyl(methyl)amino]phenyl] 2-[2-(1-ethoxyethyl)-1,3-thiazol-4-yl]acetate?
The InChIKey is RUBLLLLSFXNZNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H28N2O4S/c1-7-26-14(2)19-22-15(13-28-19)12-18(24)27-17-10-8-16(9-11-17)23(6)20(25)21(3,4)5/h8-11,13-14H,7,12H2,1-6H3.
What are the key properties of [4-[2,2-dimethylpropanoyl(methyl)amino]phenyl] 2-[2-(1-ethoxyethyl)-1,3-thiazol-4-yl]acetate?
[4-[2,2-dimethylpropanoyl(methyl)amino]phenyl] 2-[2-(1-ethoxyethyl)-1,3-thiazol-4-yl]acetate has a molecular weight of 404.53 g/mol, XLogP of 4.40, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[2,2-dimethylpropanoyl(methyl)amino]phenyl] 2-[2-(1-ethoxyethyl)-1,3-thiazol-4-yl]acetate is sourced from PubChem (CID 86964837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).