C18H23N3O2S — CID 56797757
1-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]-2-(2-methyl-1,3-thiazol-4-yl)ethanone (PubChem CID 56797757) has the molecular formula C18H23N3O2S and a molecular weight of 345.47 g/mol. Its IUPAC name is 1-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]-2-(2-methyl-1,3-thiazol-4-yl)ethanone.
| Compound Name | 1-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]-2-(2-methyl-1,3-thiazol-4-yl)ethanone |
|---|---|
| PubChem CID | 56797757 |
| Molecular Formula | C18H23N3O2S |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | 1-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]-2-(2-methyl-1,3-thiazol-4-yl)ethanone |
| SMILES | COc1ccc(N2CCCN(C(=O)Cc3csc(C)n3)CC2)cc1 |
| InChI | InChI=1S/C18H23N3O2S/c1-14-19-15(13-24-14)12-18(22)21-9-3-8-20(10-11-21)16-4-6-17(23-2)7-5-16/h4-7,13H,3,8-12H2,1-2H3 |
| InChIKey | JSLKJPJTUYRSPB-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|