C17H13Cl3N2O2S — CID 58910662
4-(2,4-dimethoxyphenyl)-N-(2,4,5-trichlorophenyl)-1,3-thiazol-2-amine (PubChem CID 58910662) has the molecular formula C17H13Cl3N2O2S and a molecular weight of 415.73 g/mol. Its IUPAC name is 4-(2,4-dimethoxyphenyl)-N-(2,4,5-trichlorophenyl)-1,3-thiazol-2-amine.
| Compound Name | 4-(2,4-dimethoxyphenyl)-N-(2,4,5-trichlorophenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 58910662 |
| Molecular Formula | C17H13Cl3N2O2S |
| Molecular Weight | 415.73 g/mol |
| Exact Mass | 413.98 |
| IUPAC Name | 4-(2,4-dimethoxyphenyl)-N-(2,4,5-trichlorophenyl)-1,3-thiazol-2-amine |
| SMILES | COc1ccc(-c2csc(Nc3cc(Cl)c(Cl)cc3Cl)n2)c(OC)c1 |
| InChI | InChI=1S/C17H13Cl3N2O2S/c1-23-9-3-4-10(16(5-9)24-2)15-8-25-17(22-15)21-14-7-12(19)11(18)6-13(14)20/h3-8H,1-2H3,(H,21,22) |
| InChIKey | HCUHQHNEJMDMTI-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.73 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|