C22H18ClN3O2S — CID 150886368
2-(4-aminophenyl)-4-chloro-5-[[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]amino]phenol (PubChem CID 150886368) has the molecular formula C22H18ClN3O2S and a molecular weight of 423.93 g/mol. Its IUPAC name is 2-(4-aminophenyl)-4-chloro-5-[[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]amino]phenol.
| Compound Name | 2-(4-aminophenyl)-4-chloro-5-[[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]amino]phenol |
|---|---|
| PubChem CID | 150886368 |
| Molecular Formula | C22H18ClN3O2S |
| Molecular Weight | 423.93 g/mol |
| Exact Mass | 423.08 |
| IUPAC Name | 2-(4-aminophenyl)-4-chloro-5-[[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]amino]phenol |
| SMILES | COc1ccc(-c2csc(Nc3cc(O)c(-c4ccc(N)cc4)cc3Cl)n2)cc1 |
| InChI | InChI=1S/C22H18ClN3O2S/c1-28-16-8-4-14(5-9-16)20-12-29-22(26-20)25-19-11-21(27)17(10-18(19)23)13-2-6-15(24)7-3-13/h2-12,27H,24H2,1H3,(H,25,26) |
| InChIKey | KXCAYYUZKBULTO-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 80.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.93 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|