C17H14Cl2N2O2S — CID 58496015
N-(2,4-dichlorophenyl)-4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-amine (PubChem CID 58496015) has the molecular formula C17H14Cl2N2O2S and a molecular weight of 381.28 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-amine.
| Compound Name | N-(2,4-dichlorophenyl)-4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 58496015 |
| Molecular Formula | C17H14Cl2N2O2S |
| Molecular Weight | 381.28 g/mol |
| Exact Mass | 380.02 |
| IUPAC Name | N-(2,4-dichlorophenyl)-4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-amine |
| SMILES | COc1ccc(OC)c(-c2csc(Nc3ccc(Cl)cc3Cl)n2)c1 |
| InChI | InChI=1S/C17H14Cl2N2O2S/c1-22-11-4-6-16(23-2)12(8-11)15-9-24-17(21-15)20-14-5-3-10(18)7-13(14)19/h3-9H,1-2H3,(H,20,21) |
| InChIKey | XMFCXQWHNHCXIR-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.28 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |