C16H18N2O3S — CID 30659809
N-[4-(2,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-3-methylbut-2-enamide (PubChem CID 30659809) has the molecular formula C16H18N2O3S and a molecular weight of 318.40 g/mol. Its IUPAC name is N-[4-(2,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-3-methylbut-2-enamide.
| Compound Name | N-[4-(2,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-3-methylbut-2-enamide |
|---|---|
| PubChem CID | 30659809 |
| Molecular Formula | C16H18N2O3S |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | N-[4-(2,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-3-methylbut-2-enamide |
| SMILES | COc1ccc(-c2csc(NC(=O)C=C(C)C)n2)c(OC)c1 |
| InChI | InChI=1S/C16H18N2O3S/c1-10(2)7-15(19)18-16-17-13(9-22-16)12-6-5-11(20-3)8-14(12)21-4/h5-9H,1-4H3,(H,17,18,19) |
| InChIKey | QSGHCNBPWYFRQO-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|