C21H18F2N2O4S — CID 16594041
(E)-3-[2-(difluoromethoxy)phenyl]-N-[4-(2,4-dimethoxyphenyl)-1,3-thiazol-2-yl]prop-2-enamide (PubChem CID 16594041) has the molecular formula C21H18F2N2O4S and a molecular weight of 432.45 g/mol. Its IUPAC name is (E)-3-[2-(difluoromethoxy)phenyl]-N-[4-(2,4-dimethoxyphenyl)-1,3-thiazol-2-yl]prop-2-enamide.
| Compound Name | (E)-3-[2-(difluoromethoxy)phenyl]-N-[4-(2,4-dimethoxyphenyl)-1,3-thiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 16594041 |
| Molecular Formula | C21H18F2N2O4S |
| Molecular Weight | 432.45 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | (E)-3-[2-(difluoromethoxy)phenyl]-N-[4-(2,4-dimethoxyphenyl)-1,3-thiazol-2-yl]prop-2-enamide |
| SMILES | COc1ccc(-c2csc(NC(=O)/C=C/c3ccccc3OC(F)F)n2)c(OC)c1 |
| InChI | InChI=1S/C21H18F2N2O4S/c1-27-14-8-9-15(18(11-14)28-2)16-12-30-21(24-16)25-19(26)10-7-13-5-3-4-6-17(13)29-20(22)23/h3-12,20H,1-2H3,(H,24,25,26)/b10-7+ |
| InChIKey | DNFLRXNTAQYFPN-JXMROGBWSA-N |
| XLogP | 5.08 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.45 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|