C20H17F2N3O3S2 — CID 16600602
(E)-N-[4-[5-(acetamidomethyl)thiophen-2-yl]-1,3-thiazol-2-yl]-3-[2-(difluoromethoxy)phenyl]prop-2-enamide (PubChem CID 16600602) has the molecular formula C20H17F2N3O3S2 and a molecular weight of 449.50 g/mol. Its IUPAC name is (E)-N-[4-[5-(acetamidomethyl)thiophen-2-yl]-1,3-thiazol-2-yl]-3-[2-(difluoromethoxy)phenyl]prop-2-enamide.
| Compound Name | (E)-N-[4-[5-(acetamidomethyl)thiophen-2-yl]-1,3-thiazol-2-yl]-3-[2-(difluoromethoxy)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 16600602 |
| Molecular Formula | C20H17F2N3O3S2 |
| Molecular Weight | 449.50 g/mol |
| Exact Mass | 449.07 |
| IUPAC Name | (E)-N-[4-[5-(acetamidomethyl)thiophen-2-yl]-1,3-thiazol-2-yl]-3-[2-(difluoromethoxy)phenyl]prop-2-enamide |
| SMILES | CC(=O)NCc1ccc(-c2csc(NC(=O)/C=C/c3ccccc3OC(F)F)n2)s1 |
| InChI | InChI=1S/C20H17F2N3O3S2/c1-12(26)23-10-14-7-8-17(30-14)15-11-29-20(24-15)25-18(27)9-6-13-4-2-3-5-16(13)28-19(21)22/h2-9,11,19H,10H2,1H3,(H,23,26)(H,24,25,27)/b9-6+ |
| InChIKey | IKNSDNKTZYVXKL-RMKNXTFCSA-N |
| XLogP | 4.76 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.50 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|