C15H12F2N2O3S — CID 43040220
(E)-N-(4-acetyl-1,3-thiazol-2-yl)-3-[2-(difluoromethoxy)phenyl]prop-2-enamide (PubChem CID 43040220) has the molecular formula C15H12F2N2O3S and a molecular weight of 338.34 g/mol. Its IUPAC name is (E)-N-(4-acetyl-1,3-thiazol-2-yl)-3-[2-(difluoromethoxy)phenyl]prop-2-enamide.
| Compound Name | (E)-N-(4-acetyl-1,3-thiazol-2-yl)-3-[2-(difluoromethoxy)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 43040220 |
| Molecular Formula | C15H12F2N2O3S |
| Molecular Weight | 338.34 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | (E)-N-(4-acetyl-1,3-thiazol-2-yl)-3-[2-(difluoromethoxy)phenyl]prop-2-enamide |
| SMILES | CC(=O)c1csc(NC(=O)/C=C/c2ccccc2OC(F)F)n1 |
| InChI | InChI=1S/C15H12F2N2O3S/c1-9(20)11-8-23-15(18-11)19-13(21)7-6-10-4-2-3-5-12(10)22-14(16)17/h2-8,14H,1H3,(H,18,19,21)/b7-6+ |
| InChIKey | LNSTVJGJJDFAEL-VOTSOKGWSA-N |
| XLogP | 3.60 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.34 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|