C22H19BrF2N2O2S — CID 3481545
3-[5-bromo-2-(difluoromethoxy)phenyl]-N-[4-(2,4,6-trimethylphenyl)-1,3-thiazol-2-yl]prop-2-enamide (PubChem CID 3481545) has the molecular formula C22H19BrF2N2O2S and a molecular weight of 493.37 g/mol. Its IUPAC name is 3-[5-bromo-2-(difluoromethoxy)phenyl]-N-[4-(2,4,6-trimethylphenyl)-1,3-thiazol-2-yl]prop-2-enamide.
| Compound Name | 3-[5-bromo-2-(difluoromethoxy)phenyl]-N-[4-(2,4,6-trimethylphenyl)-1,3-thiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 3481545 |
| Molecular Formula | C22H19BrF2N2O2S |
| Molecular Weight | 493.37 g/mol |
| Exact Mass | 492.03 |
| IUPAC Name | 3-[5-bromo-2-(difluoromethoxy)phenyl]-N-[4-(2,4,6-trimethylphenyl)-1,3-thiazol-2-yl]prop-2-enamide |
| SMILES | Cc1cc(C)c(-c2csc(NC(=O)C=Cc3cc(Br)ccc3OC(F)F)n2)c(C)c1 |
| InChI | InChI=1S/C22H19BrF2N2O2S/c1-12-8-13(2)20(14(3)9-12)17-11-30-22(26-17)27-19(28)7-4-15-10-16(23)5-6-18(15)29-21(24)25/h4-11,21H,1-3H3,(H,26,27,28) |
| InChIKey | YZANEESGIWELOC-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.37 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|