C19H13BrF2N2O4 — CID 31508262
(E)-3-[5-bromo-2-(difluoromethoxy)phenyl]-N-(2-methyl-1,3-dioxoisoindol-5-yl)prop-2-enamide (PubChem CID 31508262) has the molecular formula C19H13BrF2N2O4 and a molecular weight of 451.22 g/mol. Its IUPAC name is (E)-3-[5-bromo-2-(difluoromethoxy)phenyl]-N-(2-methyl-1,3-dioxoisoindol-5-yl)prop-2-enamide.
| Compound Name | (E)-3-[5-bromo-2-(difluoromethoxy)phenyl]-N-(2-methyl-1,3-dioxoisoindol-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 31508262 |
| Molecular Formula | C19H13BrF2N2O4 |
| Molecular Weight | 451.22 g/mol |
| Exact Mass | 450.00 |
| IUPAC Name | (E)-3-[5-bromo-2-(difluoromethoxy)phenyl]-N-(2-methyl-1,3-dioxoisoindol-5-yl)prop-2-enamide |
| SMILES | CN1C(=O)c2ccc(NC(=O)/C=C/c3cc(Br)ccc3OC(F)F)cc2C1=O |
| InChI | InChI=1S/C19H13BrF2N2O4/c1-24-17(26)13-5-4-12(9-14(13)18(24)27)23-16(25)7-2-10-8-11(20)3-6-15(10)28-19(21)22/h2-9,19H,1H3,(H,23,25)/b7-2+ |
| InChIKey | XFNNIPWECPTFHQ-FARCUNLSSA-N |
| XLogP | 3.93 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.22 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|