C17H10BrClF2N2O2S2 — CID 2574687
(E)-3-[5-bromo-2-(difluoromethoxy)phenyl]-N-[4-(5-chlorothiophen-2-yl)-1,3-thiazol-2-yl]prop-2-enamide (PubChem CID 2574687) has the molecular formula C17H10BrClF2N2O2S2 and a molecular weight of 491.77 g/mol. Its IUPAC name is (E)-3-[5-bromo-2-(difluoromethoxy)phenyl]-N-[4-(5-chlorothiophen-2-yl)-1,3-thiazol-2-yl]prop-2-enamide.
| Compound Name | (E)-3-[5-bromo-2-(difluoromethoxy)phenyl]-N-[4-(5-chlorothiophen-2-yl)-1,3-thiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 2574687 |
| Molecular Formula | C17H10BrClF2N2O2S2 |
| Molecular Weight | 491.77 g/mol |
| Exact Mass | 489.90 |
| IUPAC Name | (E)-3-[5-bromo-2-(difluoromethoxy)phenyl]-N-[4-(5-chlorothiophen-2-yl)-1,3-thiazol-2-yl]prop-2-enamide |
| SMILES | O=C(/C=C/c1cc(Br)ccc1OC(F)F)Nc1nc(-c2ccc(Cl)s2)cs1 |
| InChI | InChI=1S/C17H10BrClF2N2O2S2/c18-10-2-3-12(25-16(20)21)9(7-10)1-6-15(24)23-17-22-11(8-26-17)13-4-5-14(19)27-13/h1-8,16H,(H,22,23,24)/b6-1+ |
| InChIKey | WPZZLNDNJSUGPZ-LZCJLJQNSA-N |
| XLogP | 6.54 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.77 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|