C15H13N3O2S — CID 60529099
4-(2,4-dimethoxyphenyl)-2-pyrazin-2-yl-1,3-thiazole (PubChem CID 60529099) has the molecular formula C15H13N3O2S and a molecular weight of 299.36 g/mol. Its IUPAC name is 4-(2,4-dimethoxyphenyl)-2-pyrazin-2-yl-1,3-thiazole.
| Compound Name | 4-(2,4-dimethoxyphenyl)-2-pyrazin-2-yl-1,3-thiazole |
|---|---|
| PubChem CID | 60529099 |
| Molecular Formula | C15H13N3O2S |
| Molecular Weight | 299.36 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | 4-(2,4-dimethoxyphenyl)-2-pyrazin-2-yl-1,3-thiazole |
| SMILES | COc1ccc(-c2csc(-c3cnccn3)n2)c(OC)c1 |
| InChI | InChI=1S/C15H13N3O2S/c1-19-10-3-4-11(14(7-10)20-2)13-9-21-15(18-13)12-8-16-5-6-17-12/h3-9H,1-2H3 |
| InChIKey | KTOGLJPXKHPQHR-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.36 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |