C13H14BrN3S — CID 134273339
4-bromo-2-(2-piperidin-1-yl-4-pyridinyl)-1,3-thiazole (PubChem CID 134273339) has the molecular formula C13H14BrN3S and a molecular weight of 324.25 g/mol. Its IUPAC name is 4-bromo-2-(2-piperidin-1-yl-4-pyridinyl)-1,3-thiazole.
| Compound Name | 4-bromo-2-(2-piperidin-1-yl-4-pyridinyl)-1,3-thiazole |
|---|---|
| PubChem CID | 134273339 |
| Molecular Formula | C13H14BrN3S |
| Molecular Weight | 324.25 g/mol |
| Exact Mass | 323.01 |
| IUPAC Name | 4-bromo-2-(2-piperidin-1-yl-4-pyridinyl)-1,3-thiazole |
| SMILES | Brc1csc(-c2ccnc(N3CCCCC3)c2)n1 |
| InChI | InChI=1S/C13H14BrN3S/c14-11-9-18-13(16-11)10-4-5-15-12(8-10)17-6-2-1-3-7-17/h4-5,8-9H,1-3,6-7H2 |
| InChIKey | JLXOUOKZJDVNCB-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.25 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |