C19H17FN4O3 — CID 60613312
(E)-N-[5-(2,4-dimethoxyphenyl)-1H-1,2,4-triazol-3-yl]-3-(4-fluorophenyl)prop-2-enamide (PubChem CID 60613312) has the molecular formula C19H17FN4O3 and a molecular weight of 368.37 g/mol. Its IUPAC name is (E)-N-[5-(2,4-dimethoxyphenyl)-1H-1,2,4-triazol-3-yl]-3-(4-fluorophenyl)prop-2-enamide.
| Compound Name | (E)-N-[5-(2,4-dimethoxyphenyl)-1H-1,2,4-triazol-3-yl]-3-(4-fluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 60613312 |
| Molecular Formula | C19H17FN4O3 |
| Molecular Weight | 368.37 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | (E)-N-[5-(2,4-dimethoxyphenyl)-1H-1,2,4-triazol-3-yl]-3-(4-fluorophenyl)prop-2-enamide |
| SMILES | COc1ccc(-c2nc(NC(=O)/C=C/c3ccc(F)cc3)n[nH]2)c(OC)c1 |
| InChI | InChI=1S/C19H17FN4O3/c1-26-14-8-9-15(16(11-14)27-2)18-22-19(24-23-18)21-17(25)10-5-12-3-6-13(20)7-4-12/h3-11H,1-2H3,(H2,21,22,23,24,25)/b10-5+ |
| InChIKey | VLPRWRKCDZZXDK-BJMVGYQFSA-N |
| XLogP | 3.28 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.37 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|