C20H16ClF3N4O3 — CID 60613261
(E)-3-[4-chloro-3-(trifluoromethyl)phenyl]-N-[5-(2,4-dimethoxyphenyl)-1H-1,2,4-triazol-3-yl]prop-2-enamide (PubChem CID 60613261) has the molecular formula C20H16ClF3N4O3 and a molecular weight of 452.82 g/mol. Its IUPAC name is (E)-3-[4-chloro-3-(trifluoromethyl)phenyl]-N-[5-(2,4-dimethoxyphenyl)-1H-1,2,4-triazol-3-yl]prop-2-enamide.
| Compound Name | (E)-3-[4-chloro-3-(trifluoromethyl)phenyl]-N-[5-(2,4-dimethoxyphenyl)-1H-1,2,4-triazol-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 60613261 |
| Molecular Formula | C20H16ClF3N4O3 |
| Molecular Weight | 452.82 g/mol |
| Exact Mass | 452.09 |
| IUPAC Name | (E)-3-[4-chloro-3-(trifluoromethyl)phenyl]-N-[5-(2,4-dimethoxyphenyl)-1H-1,2,4-triazol-3-yl]prop-2-enamide |
| SMILES | COc1ccc(-c2nc(NC(=O)/C=C/c3ccc(Cl)c(C(F)(F)F)c3)n[nH]2)c(OC)c1 |
| InChI | InChI=1S/C20H16ClF3N4O3/c1-30-12-5-6-13(16(10-12)31-2)18-26-19(28-27-18)25-17(29)8-4-11-3-7-15(21)14(9-11)20(22,23)24/h3-10H,1-2H3,(H2,25,26,27,28,29)/b8-4+ |
| InChIKey | BIYOGYLJEIQRDI-XBXARRHUSA-N |
| XLogP | 4.81 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.82 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|