C14H10ClF3N2O2 — CID 18863191
(E)-3-[4-chloro-3-(trifluoromethyl)phenyl]-N-(5-methyl-1,2-oxazol-3-yl)prop-2-enamide (PubChem CID 18863191) has the molecular formula C14H10ClF3N2O2 and a molecular weight of 330.69 g/mol. Its IUPAC name is (E)-3-[4-chloro-3-(trifluoromethyl)phenyl]-N-(5-methyl-1,2-oxazol-3-yl)prop-2-enamide.
| Compound Name | (E)-3-[4-chloro-3-(trifluoromethyl)phenyl]-N-(5-methyl-1,2-oxazol-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 18863191 |
| Molecular Formula | C14H10ClF3N2O2 |
| Molecular Weight | 330.69 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | (E)-3-[4-chloro-3-(trifluoromethyl)phenyl]-N-(5-methyl-1,2-oxazol-3-yl)prop-2-enamide |
| SMILES | Cc1cc(NC(=O)/C=C/c2ccc(Cl)c(C(F)(F)F)c2)no1 |
| InChI | InChI=1S/C14H10ClF3N2O2/c1-8-6-12(20-22-8)19-13(21)5-3-9-2-4-11(15)10(7-9)14(16,17)18/h2-7H,1H3,(H,19,20,21)/b5-3+ |
| InChIKey | XHWACYAAQFFDMA-HWKANZROSA-N |
| XLogP | 4.31 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.69 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|