C17H20N2O2 — CID 896549
(E)-3-(4-tert-butylphenyl)-N-(5-methyl-1,2-oxazol-3-yl)prop-2-enamide (PubChem CID 896549) has the molecular formula C17H20N2O2 and a molecular weight of 284.36 g/mol. Its IUPAC name is (E)-3-(4-tert-butylphenyl)-N-(5-methyl-1,2-oxazol-3-yl)prop-2-enamide.
| Compound Name | (E)-3-(4-tert-butylphenyl)-N-(5-methyl-1,2-oxazol-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 896549 |
| Molecular Formula | C17H20N2O2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | (E)-3-(4-tert-butylphenyl)-N-(5-methyl-1,2-oxazol-3-yl)prop-2-enamide |
| SMILES | Cc1cc(NC(=O)/C=C/c2ccc(C(C)(C)C)cc2)no1 |
| InChI | InChI=1S/C17H20N2O2/c1-12-11-15(19-21-12)18-16(20)10-7-13-5-8-14(9-6-13)17(2,3)4/h5-11H,1-4H3,(H,18,19,20)/b10-7+ |
| InChIKey | QXZKTKHUBSFQLG-JXMROGBWSA-N |
| XLogP | 3.93 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|