C18H11ClF3N3O3 — CID 136696067
(Z)-3-[4-chloro-3-(trifluoromethyl)phenyl]-N-[4-(5-oxo-4H-1,2,4-oxadiazol-3-yl)phenyl]prop-2-enamide (PubChem CID 136696067) has the molecular formula C18H11ClF3N3O3 and a molecular weight of 409.75 g/mol. Its IUPAC name is (Z)-3-[4-chloro-3-(trifluoromethyl)phenyl]-N-[4-(5-oxo-4H-1,2,4-oxadiazol-3-yl)phenyl]prop-2-enamide.
| Compound Name | (Z)-3-[4-chloro-3-(trifluoromethyl)phenyl]-N-[4-(5-oxo-4H-1,2,4-oxadiazol-3-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 136696067 |
| Molecular Formula | C18H11ClF3N3O3 |
| Molecular Weight | 409.75 g/mol |
| Exact Mass | 409.04 |
| IUPAC Name | (Z)-3-[4-chloro-3-(trifluoromethyl)phenyl]-N-[4-(5-oxo-4H-1,2,4-oxadiazol-3-yl)phenyl]prop-2-enamide |
| SMILES | O=C(/C=C\c1ccc(Cl)c(C(F)(F)F)c1)Nc1ccc(-c2noc(=O)[nH]2)cc1 |
| InChI | InChI=1S/C18H11ClF3N3O3/c19-14-7-1-10(9-13(14)18(20,21)22)2-8-15(26)23-12-5-3-11(4-6-12)16-24-17(27)28-25-16/h1-9H,(H,23,26)(H,24,25,27)/b8-2- |
| InChIKey | XZQUQTDOWFBSAK-WAPJZHGLSA-N |
| XLogP | 4.35 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.75 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|