C22H23ClF3N3O — CID 46807397
(E)-3-[4-chloro-3-(trifluoromethyl)phenyl]-N-[4-(4-ethylpiperazin-1-yl)phenyl]prop-2-enamide (PubChem CID 46807397) has the molecular formula C22H23ClF3N3O and a molecular weight of 437.89 g/mol. Its IUPAC name is (E)-3-[4-chloro-3-(trifluoromethyl)phenyl]-N-[4-(4-ethylpiperazin-1-yl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-[4-chloro-3-(trifluoromethyl)phenyl]-N-[4-(4-ethylpiperazin-1-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 46807397 |
| Molecular Formula | C22H23ClF3N3O |
| Molecular Weight | 437.89 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | (E)-3-[4-chloro-3-(trifluoromethyl)phenyl]-N-[4-(4-ethylpiperazin-1-yl)phenyl]prop-2-enamide |
| SMILES | CCN1CCN(c2ccc(NC(=O)/C=C/c3ccc(Cl)c(C(F)(F)F)c3)cc2)CC1 |
| InChI | InChI=1S/C22H23ClF3N3O/c1-2-28-11-13-29(14-12-28)18-7-5-17(6-8-18)27-21(30)10-4-16-3-9-20(23)19(15-16)22(24,25)26/h3-10,15H,2,11-14H2,1H3,(H,27,30)/b10-4+ |
| InChIKey | DOVMQKBZCVZRQD-ONNFQVAWSA-N |
| XLogP | 5.15 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.89 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|