C13H12N2O4 — CID 157011122
5-(6-methoxy-1,3-benzodioxol-5-yl)-3-methyl-1H-pyridazin-6-one (PubChem CID 157011122) has the molecular formula C13H12N2O4 and a molecular weight of 260.25 g/mol. Its IUPAC name is 5-(6-methoxy-1,3-benzodioxol-5-yl)-3-methyl-1H-pyridazin-6-one.
| Compound Name | 5-(6-methoxy-1,3-benzodioxol-5-yl)-3-methyl-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 157011122 |
| Molecular Formula | C13H12N2O4 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 5-(6-methoxy-1,3-benzodioxol-5-yl)-3-methyl-1H-pyridazin-6-one |
| SMILES | COc1cc2c(cc1-c1cc(C)n[nH]c1=O)OCO2 |
| InChI | InChI=1S/C13H12N2O4/c1-7-3-9(13(16)15-14-7)8-4-11-12(19-6-18-11)5-10(8)17-2/h3-5H,6H2,1-2H3,(H,15,16) |
| InChIKey | MPTUALBPLLUSOW-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 73.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |