C13H10FNO3 — CID 163311853
3-fluoro-4-(6-methoxy-1,3-benzodioxol-5-yl)pyridine (PubChem CID 163311853) has the molecular formula C13H10FNO3 and a molecular weight of 247.22 g/mol. Its IUPAC name is 3-fluoro-4-(6-methoxy-1,3-benzodioxol-5-yl)pyridine.
| Compound Name | 3-fluoro-4-(6-methoxy-1,3-benzodioxol-5-yl)pyridine |
|---|---|
| PubChem CID | 163311853 |
| Molecular Formula | C13H10FNO3 |
| Molecular Weight | 247.22 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | 3-fluoro-4-(6-methoxy-1,3-benzodioxol-5-yl)pyridine |
| SMILES | COc1cc2c(cc1-c1ccncc1F)OCO2 |
| InChI | InChI=1S/C13H10FNO3/c1-16-11-5-13-12(17-7-18-13)4-9(11)8-2-3-15-6-10(8)14/h2-6H,7H2,1H3 |
| InChIKey | UQUJYBYQHFEXGL-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.22 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |