C12H11N3O3 — CID 163307237
5-(6-methoxy-1,3-benzodioxol-5-yl)pyrimidin-2-amine (PubChem CID 163307237) has the molecular formula C12H11N3O3 and a molecular weight of 245.24 g/mol. Its IUPAC name is 5-(6-methoxy-1,3-benzodioxol-5-yl)pyrimidin-2-amine.
| Compound Name | 5-(6-methoxy-1,3-benzodioxol-5-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 163307237 |
| Molecular Formula | C12H11N3O3 |
| Molecular Weight | 245.24 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | 5-(6-methoxy-1,3-benzodioxol-5-yl)pyrimidin-2-amine |
| SMILES | COc1cc2c(cc1-c1cnc(N)nc1)OCO2 |
| InChI | InChI=1S/C12H11N3O3/c1-16-9-3-11-10(17-6-18-11)2-8(9)7-4-14-12(13)15-5-7/h2-5H,6H2,1H3,(H2,13,14,15) |
| InChIKey | GKWRMYQTIXRMGF-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 79.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.24 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |