C17H19N3O3 — CID 162633091
N-cyclopentyl-6-(6-methoxy-1,3-benzodioxol-5-yl)pyridazin-3-amine (PubChem CID 162633091) has the molecular formula C17H19N3O3 and a molecular weight of 313.36 g/mol. Its IUPAC name is N-cyclopentyl-6-(6-methoxy-1,3-benzodioxol-5-yl)pyridazin-3-amine.
| Compound Name | N-cyclopentyl-6-(6-methoxy-1,3-benzodioxol-5-yl)pyridazin-3-amine |
|---|---|
| PubChem CID | 162633091 |
| Molecular Formula | C17H19N3O3 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | N-cyclopentyl-6-(6-methoxy-1,3-benzodioxol-5-yl)pyridazin-3-amine |
| SMILES | COc1cc2c(cc1-c1ccc(NC3CCCC3)nn1)OCO2 |
| InChI | InChI=1S/C17H19N3O3/c1-21-14-9-16-15(22-10-23-16)8-12(14)13-6-7-17(20-19-13)18-11-4-2-3-5-11/h6-9,11H,2-5,10H2,1H3,(H,18,20) |
| InChIKey | HUQTWFBGZFYLFH-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 65.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |